About 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid
3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid (PubChem CID 51350140) has the molecular formula C25H26O4
and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid |
| PubChem CID | 51350140 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid |
| SMILES | COc1cc(OCc2cccc(-c3c(C)cccc3C)c2)ccc1CCC(=O)O |
| InChI | InChI=1S/C25H26O4/c1-17-6-4-7-18(2)25(17)21-9-5-8-19(14-21)16-29-22-12-10-20(11-13-24(26)27)23(15-22)28-3/h4-10,12,14-15H,11,13,16H2,1-3H3,(H,26,27) |
| InChIKey | ABCSQINXDHMUDI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid?
The IUPAC name of 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid (CID 51350140) is 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid.
What is the SMILES notation for 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid?
The canonical SMILES for 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid is COc1cc(OCc2cccc(-c3c(C)cccc3C)c2)ccc1CCC(=O)O.
What is the InChIKey of 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid?
The InChIKey is ABCSQINXDHMUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O4/c1-17-6-4-7-18(2)25(17)21-9-5-8-19(14-21)16-29-22-12-10-20(11-13-24(26)27)23(15-22)28-3/h4-10,12,14-15H,11,13,16H2,1-3H3,(H,26,27).
What are the key properties of 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid?
3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid has a molecular weight of 390.48 g/mol, XLogP of 5.58, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-2-methoxyphenyl]propanoic acid is sourced from PubChem (CID 51350140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).