C14H10BrNO3 — CID 5135025
6-bromo-3-hydroxy-3-(2-hydroxyphenyl)-1H-indol-2-one (PubChem CID 5135025) has the molecular formula C14H10BrNO3 and a molecular weight of 320.14 g/mol. Its IUPAC name is 6-bromo-3-hydroxy-3-(2-hydroxyphenyl)-1H-indol-2-one.
| Compound Name | 6-bromo-3-hydroxy-3-(2-hydroxyphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 5135025 |
| Molecular Formula | C14H10BrNO3 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 6-bromo-3-hydroxy-3-(2-hydroxyphenyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Br)ccc2C1(O)c1ccccc1O |
| InChI | InChI=1S/C14H10BrNO3/c15-8-5-6-9-11(7-8)16-13(18)14(9,19)10-3-1-2-4-12(10)17/h1-7,17,19H,(H,16,18) |
| InChIKey | WLDGKMDRSCCBRJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |