C24H25NO4 — CID 51350260
6,8,8-triethyl-5-hydroxy-2-(1-methylindol-3-yl)chromene-4,7-dione (PubChem CID 51350260) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 6,8,8-triethyl-5-hydroxy-2-(1-methylindol-3-yl)chromene-4,7-dione.
| Compound Name | 6,8,8-triethyl-5-hydroxy-2-(1-methylindol-3-yl)chromene-4,7-dione |
|---|---|
| PubChem CID | 51350260 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 6,8,8-triethyl-5-hydroxy-2-(1-methylindol-3-yl)chromene-4,7-dione |
| SMILES | CCC1=C(O)c2c(oc(-c3cn(C)c4ccccc34)cc2=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C24H25NO4/c1-5-14-21(27)20-18(26)12-19(29-23(20)24(6-2,7-3)22(14)28)16-13-25(4)17-11-9-8-10-15(16)17/h8-13,27H,5-7H2,1-4H3 |
| InChIKey | ZJKHMZDOTKJDFO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |