C22H20N4O — CID 51350281
3-[(E)-2-[4-(3-methylbut-2-enoxy)phenyl]ethenyl]-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 51350281) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[(E)-2-[4-(3-methylbut-2-enoxy)phenyl]ethenyl]-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 3-[(E)-2-[4-(3-methylbut-2-enoxy)phenyl]ethenyl]-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 51350281 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-[(E)-2-[4-(3-methylbut-2-enoxy)phenyl]ethenyl]-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | CC(C)=CCOc1ccc(/C=C/c2nnc3c4ccccc4cnn23)cc1 |
| InChI | InChI=1S/C22H20N4O/c1-16(2)13-14-27-19-10-7-17(8-11-19)9-12-21-24-25-22-20-6-4-3-5-18(20)15-23-26(21)22/h3-13,15H,14H2,1-2H3/b12-9+ |
| InChIKey | VFGQUUPNQFRWHZ-FMIVXFBMSA-N |
| XLogP | 4.79 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|