About CID 51350305
CID 51350305 (PubChem CID 51350305) has the molecular formula C59H58BF2IN2O8
and a molecular weight of 1098.83 g/mol.
Molecular Properties
| Compound Name | CID 51350305 |
| PubChem CID | 51350305 |
| Molecular Formula | C59H58BF2IN2O8 |
| Molecular Weight | 1098.83 g/mol |
| Exact Mass | 1098.33 |
| IUPAC Name | — |
| SMILES | COCCOCCOc1ccc(/C=C/c2cc(/C=C/c3ccc(OC)cc3)n3c2[C+](c2ccc(I)cc2)c2c(/C=C/c4ccc(OCCOCCOC)cc4)cc(/C=C/c4ccc(OC)cc4)n2[B-]3(F)F)cc1 |
| InChI | InChI=1S/C59H58BF2IN2O8/c1-66-33-35-70-37-39-72-55-29-13-43(14-30-55)5-17-48-41-51(23-7-45-9-25-53(68-3)26-10-45)64-58(48)57(47-19-21-50(63)22-20-47)59-49(18-6-44-15-31-56(32-16-44)73-40-38-71-36-34-67-2)42-52(65(59)60(64,61)62)24-8-46-11-27-54(69-4)28-12-46/h5-32,41-42H,33-40H2,1-4H3/b17-5+,18-6+,23-7+,24-8+ |
| InChIKey | LINWPYCRUBQSKZ-QYXXAPOBSA-N |
| XLogP | 12.78 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1098.83 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 51350305 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 51350305?
The IUPAC name of CID 51350305 (CID 51350305) is not available.
What is the SMILES notation for CID 51350305?
The canonical SMILES for CID 51350305 is COCCOCCOc1ccc(/C=C/c2cc(/C=C/c3ccc(OC)cc3)n3c2[C+](c2ccc(I)cc2)c2c(/C=C/c4ccc(OCCOCCOC)cc4)cc(/C=C/c4ccc(OC)cc4)n2[B-]3(F)F)cc1.
What is the InChIKey of CID 51350305?
The InChIKey is LINWPYCRUBQSKZ-QYXXAPOBSA-N. The full InChI is InChI=1S/C59H58BF2IN2O8/c1-66-33-35-70-37-39-72-55-29-13-43(14-30-55)5-17-48-41-51(23-7-45-9-25-53(68-3)26-10-45)64-58(48)57(47-19-21-50(63)22-20-47)59-49(18-6-44-15-31-56(32-16-44)73-40-38-71-36-34-67-2)42-52(65(59)60(64,61)62)24-8-46-11-27-54(69-4)28-12-46/h5-32,41-42H,33-40H2,1-4H3/b17-5+,18-6+,23-7+,24-8+.
What are the key properties of CID 51350305?
CID 51350305 has a molecular weight of 1098.83 g/mol, XLogP of 12.78, 25 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 51350305 is sourced from PubChem (CID 51350305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).