About 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one
1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one (PubChem CID 513506) has the molecular formula C11H16N2O5S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one.
Molecular Properties
| Compound Name | 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one |
| PubChem CID | 513506 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one |
| SMILES | COC1OC(Cn2ccc(=O)nc2SC)C(O)C1O |
| InChI | InChI=1S/C11H16N2O5S/c1-17-10-9(16)8(15)6(18-10)5-13-4-3-7(14)12-11(13)19-2/h3-4,6,8-10,15-16H,5H2,1-2H3 |
| InChIKey | PLXUHLRMUJIHII-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one?
The IUPAC name of 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one (CID 513506) is 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one.
What is the SMILES notation for 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one?
The canonical SMILES for 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one is COC1OC(Cn2ccc(=O)nc2SC)C(O)C1O.
What is the InChIKey of 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one?
The InChIKey is PLXUHLRMUJIHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O5S/c1-17-10-9(16)8(15)6(18-10)5-13-4-3-7(14)12-11(13)19-2/h3-4,6,8-10,15-16H,5H2,1-2H3.
What are the key properties of 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one?
1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one has a molecular weight of 288.33 g/mol, XLogP of -0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dihydroxy-5-methoxyoxolan-2-yl)methyl]-2-methylsulfanylpyrimidin-4-one is sourced from PubChem (CID 513506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).