C34H38N4O10 — CID 51350736
ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-methoxyphenyl)-2,4-dioxopteridin-3-yl]butanoate (PubChem CID 51350736) has the molecular formula C34H38N4O10 and a molecular weight of 662.70 g/mol. Its IUPAC name is ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-methoxyphenyl)-2,4-dioxopteridin-3-yl]butanoate.
| Compound Name | ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-methoxyphenyl)-2,4-dioxopteridin-3-yl]butanoate |
|---|---|
| PubChem CID | 51350736 |
| Molecular Formula | C34H38N4O10 |
| Molecular Weight | 662.70 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-methoxyphenyl)-2,4-dioxopteridin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c(=O)c2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)nc2n([C@@H]2O[C@H](CO)[C@H]3OC(C)(C)O[C@H]32)c1=O |
| InChI | InChI=1S/C34H38N4O10/c1-6-45-24(40)8-7-17-37-31(41)27-30(38(33(37)42)32-29-28(23(18-39)46-32)47-34(2,3)48-29)36-26(20-11-15-22(44-5)16-12-20)25(35-27)19-9-13-21(43-4)14-10-19/h9-16,23,28-29,32,39H,6-8,17-18H2,1-5H3/t23-,28-,29-,32-/m1/s1 |
| InChIKey | IPRQUFPBLHDBEB-CGAVVAMDSA-N |
| XLogP | 3.06 |
| TPSA | 162.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |