C32H32F2N4O8 — CID 51350857
ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-fluorophenyl)-2,4-dioxopteridin-3-yl]butanoate (PubChem CID 51350857) has the molecular formula C32H32F2N4O8 and a molecular weight of 638.62 g/mol. Its IUPAC name is ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-fluorophenyl)-2,4-dioxopteridin-3-yl]butanoate.
| Compound Name | ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-fluorophenyl)-2,4-dioxopteridin-3-yl]butanoate |
|---|---|
| PubChem CID | 51350857 |
| Molecular Formula | C32H32F2N4O8 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | ethyl 4-[1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6,7-bis(4-fluorophenyl)-2,4-dioxopteridin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c(=O)c2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2n([C@@H]2O[C@H](CO)[C@H]3OC(C)(C)O[C@H]32)c1=O |
| InChI | InChI=1S/C32H32F2N4O8/c1-4-43-22(40)6-5-15-37-29(41)25-28(38(31(37)42)30-27-26(21(16-39)44-30)45-32(2,3)46-27)36-24(18-9-13-20(34)14-10-18)23(35-25)17-7-11-19(33)12-8-17/h7-14,21,26-27,30,39H,4-6,15-16H2,1-3H3/t21-,26-,27-,30-/m1/s1 |
| InChIKey | MVXUCDLCFILHQL-LCTTZAHCSA-N |
| XLogP | 3.32 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |