About 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one
1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 51351034) has the molecular formula C27H15F2N3O
and a molecular weight of 435.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| PubChem CID | 51351034 |
| Molecular Formula | C27H15F2N3O |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | O=c1ccc2cnc3ccc(-c4cnc5ccccc5c4)cc3c2n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H15F2N3O/c28-22-8-7-20(13-23(22)29)32-26(33)10-6-18-14-31-25-9-5-16(12-21(25)27(18)32)19-11-17-3-1-2-4-24(17)30-15-19/h1-15H |
| InChIKey | SZMGOJPKUOPRHN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one?
The IUPAC name of 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (CID 51351034) is 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
What is the SMILES notation for 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one?
The canonical SMILES for 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one is O=c1ccc2cnc3ccc(-c4cnc5ccccc5c4)cc3c2n1-c1ccc(F)c(F)c1.
What is the InChIKey of 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one?
The InChIKey is SZMGOJPKUOPRHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H15F2N3O/c28-22-8-7-20(13-23(22)29)32-26(33)10-6-18-14-31-25-9-5-16(12-21(25)27(18)32)19-11-17-3-1-2-4-24(17)30-15-19/h1-15H.
What are the key properties of 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one?
1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one has a molecular weight of 435.43 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one is sourced from PubChem (CID 51351034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).