C20H22OS2 — CID 51351480
(2'E)-2'-benzylidene-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 51351480) has the molecular formula C20H22OS2 and a molecular weight of 342.53 g/mol. Its IUPAC name is (2'E)-2'-benzylidene-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-2'-benzylidene-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 51351480 |
| Molecular Formula | C20H22OS2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2'E)-2'-benzylidene-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CC12CCC3(C=C1CC/C(=C\c1ccccc1)C2=O)SCCS3 |
| InChI | InChI=1S/C20H22OS2/c1-19-9-10-20(22-11-12-23-20)14-17(19)8-7-16(18(19)21)13-15-5-3-2-4-6-15/h2-6,13-14H,7-12H2,1H3/b16-13+ |
| InChIKey | SYQGXDGKLHKYPQ-DTQAZKPQSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|