C22H23ClN4O2 — CID 51351504
[5-(4-chlorophenyl)-1-methylpyrazol-3-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 51351504) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-methylpyrazol-3-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1-methylpyrazol-3-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51351504 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [5-(4-chlorophenyl)-1-methylpyrazol-3-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(C)n2)CC1 |
| InChI | InChI=1S/C22H23ClN4O2/c1-25-20(16-7-9-17(23)10-8-16)15-18(24-25)22(28)27-13-11-26(12-14-27)19-5-3-4-6-21(19)29-2/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | SFBJQTXZKXTYKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |