C25H31IO4 — CID 51351523
3-hydroxy-2-[(E)-3-(4-iodophenyl)prop-2-enoyl]-5-methoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one (PubChem CID 51351523) has the molecular formula C25H31IO4 and a molecular weight of 522.42 g/mol. Its IUPAC name is 3-hydroxy-2-[(E)-3-(4-iodophenyl)prop-2-enoyl]-5-methoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-2-[(E)-3-(4-iodophenyl)prop-2-enoyl]-5-methoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 51351523 |
| Molecular Formula | C25H31IO4 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 3-hydroxy-2-[(E)-3-(4-iodophenyl)prop-2-enoyl]-5-methoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
| SMILES | CCCC1=C(OC)C(CCC)(CCC)C(=O)C(C(=O)/C=C/c2ccc(I)cc2)=C1O |
| InChI | InChI=1S/C25H31IO4/c1-5-8-19-22(28)21(20(27)14-11-17-9-12-18(26)13-10-17)23(29)25(15-6-2,16-7-3)24(19)30-4/h9-14,28H,5-8,15-16H2,1-4H3/b14-11+ |
| InChIKey | FOCXUXCLSQTBSI-SDNWHVSQSA-N |
| XLogP | 6.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|