About 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone
1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone (PubChem CID 51351540) has the molecular formula C23H22ClNO
and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone |
| PubChem CID | 51351540 |
| Molecular Formula | C23H22ClNO |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CC(C)(C)C2 |
| InChI | InChI=1S/C23H22ClNO/c1-15(26)22-21(17-9-11-18(24)12-10-17)20(16-7-5-4-6-8-16)19-13-23(2,3)14-25(19)22/h4-12H,13-14H2,1-3H3 |
| InChIKey | BMSQOGZGGZOEOI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The IUPAC name of 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone (CID 51351540) is 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone.
What is the SMILES notation for 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The canonical SMILES for 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone is CC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CC(C)(C)C2.
What is the InChIKey of 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The InChIKey is BMSQOGZGGZOEOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO/c1-15(26)22-21(17-9-11-18(24)12-10-17)20(16-7-5-4-6-8-16)19-13-23(2,3)14-25(19)22/h4-12H,13-14H2,1-3H3.
What are the key properties of 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone has a molecular weight of 363.89 g/mol, XLogP of 6.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone is sourced from PubChem (CID 51351540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).