C21H35NO — CID 51351565
(E,2R,3R,8S,10S)-8,10-dimethyl-2-(methylamino)-1-phenyldodec-6-en-3-ol (PubChem CID 51351565) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (E,2R,3R,8S,10S)-8,10-dimethyl-2-(methylamino)-1-phenyldodec-6-en-3-ol.
| Compound Name | (E,2R,3R,8S,10S)-8,10-dimethyl-2-(methylamino)-1-phenyldodec-6-en-3-ol |
|---|---|
| PubChem CID | 51351565 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (E,2R,3R,8S,10S)-8,10-dimethyl-2-(methylamino)-1-phenyldodec-6-en-3-ol |
| SMILES | CC[C@H](C)C[C@H](C)/C=C/CC[C@@H](O)[C@@H](Cc1ccccc1)NC |
| InChI | InChI=1S/C21H35NO/c1-5-17(2)15-18(3)11-9-10-14-21(23)20(22-4)16-19-12-7-6-8-13-19/h6-9,11-13,17-18,20-23H,5,10,14-16H2,1-4H3/b11-9+/t17-,18+,20+,21+/m0/s1 |
| InChIKey | OSYKHOHOQPEONM-VZBQIFOISA-N |
| XLogP | 4.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|