C13H18O7S — CID 51351570
(2R,3S,4S,5S,6R)-2-benzylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 51351570) has the molecular formula C13H18O7S and a molecular weight of 318.35 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-benzylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-benzylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 51351570 |
| Molecular Formula | C13H18O7S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-benzylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | O=S(=O)(Cc1ccccc1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O7S/c14-6-9-10(15)11(16)12(17)13(20-9)21(18,19)7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | UDJIORVHQZZHIW-NAWOPXAZSA-N |
| XLogP | -1.60 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |