C14H20O6S — CID 51351571
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(2-phenylethylsulfinyl)oxane-3,4,5-triol (PubChem CID 51351571) has the molecular formula C14H20O6S and a molecular weight of 316.37 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(2-phenylethylsulfinyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(2-phenylethylsulfinyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 51351571 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(2-phenylethylsulfinyl)oxane-3,4,5-triol |
| SMILES | O=S(CCc1ccccc1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20O6S/c15-8-10-11(16)12(17)13(18)14(20-10)21(19)7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11-,12+,13+,14-,21?/m1/s1 |
| InChIKey | MXSSIIJFICBNQB-QUXRGVBESA-N |
| XLogP | -1.22 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |