C20H37NO5Si — CID 51351576
1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 51351576) has the molecular formula C20H37NO5Si and a molecular weight of 399.60 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 51351576 |
| Molecular Formula | C20H37NO5Si |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCC1[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO5Si/c1-11-12-14-16(26-27(9,10)20(5,6)7)13-15(17(22)24-8)21(14)18(23)25-19(2,3)4/h11,14-16H,1,12-13H2,2-10H3/t14?,15-,16+/m0/s1 |
| InChIKey | DPPKKOMBOLOLSZ-MERJSTESSA-N |
| XLogP | 4.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|