C16H20N2O3S — CID 51351619
(E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 51351619) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51351619 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC(C)C)ccc1/C=C/C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11(2)21-13-6-4-12(14(10-13)20-3)5-7-15(19)18-16-17-8-9-22-16/h4-7,10-11H,8-9H2,1-3H3,(H,17,18,19)/b7-5+ |
| InChIKey | SYFUSLCTJMJFGO-FNORWQNLSA-N |
| XLogP | 2.71 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|