About 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate
2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 51351663) has the molecular formula C15H20O5S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate |
| PubChem CID | 51351663 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2CC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C15H20O5S/c1-11-4-6-13(7-5-11)21(17,18)19-9-8-12-10-15(2,3)20-14(12)16/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | LKJRANIILUHHJW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate (CID 51351663) is 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCC2CC(C)(C)OC2=O)cc1.
What is the InChIKey of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate?
The InChIKey is LKJRANIILUHHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5S/c1-11-4-6-13(7-5-11)21(17,18)19-9-8-12-10-15(2,3)20-14(12)16/h4-7,12H,8-10H2,1-3H3.
What are the key properties of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate?
2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate has a molecular weight of 312.39 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 51351663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).