About 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate
2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate (PubChem CID 51351680) has the molecular formula C14H18O5S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate |
| PubChem CID | 51351680 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate |
| SMILES | CC1(C)CC(CCOS(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C14H18O5S/c1-14(2)10-11(13(15)19-14)8-9-18-20(16,17)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | YRWFQIZZZNFANG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate?
The IUPAC name of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate (CID 51351680) is 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate.
What is the SMILES notation for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate?
The canonical SMILES for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate is CC1(C)CC(CCOS(=O)(=O)c2ccccc2)C(=O)O1.
What is the InChIKey of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate?
The InChIKey is YRWFQIZZZNFANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-14(2)10-11(13(15)19-14)8-9-18-20(16,17)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3.
What are the key properties of 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate?
2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate has a molecular weight of 298.36 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl benzenesulfonate is sourced from PubChem (CID 51351680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).