About 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate
1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate (PubChem CID 51351697) has the molecular formula C14H17ClO5S
and a molecular weight of 332.81 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate |
| PubChem CID | 51351697 |
| Molecular Formula | C14H17ClO5S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate |
| SMILES | CC(OS(=O)(=O)c1ccc(Cl)cc1)C1CC(C)(C)OC1=O |
| InChI | InChI=1S/C14H17ClO5S/c1-9(12-8-14(2,3)19-13(12)16)20-21(17,18)11-6-4-10(15)5-7-11/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | QBPUSATZGKKPMW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate?
The IUPAC name of 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate (CID 51351697) is 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate.
What is the SMILES notation for 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate?
The canonical SMILES for 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate is CC(OS(=O)(=O)c1ccc(Cl)cc1)C1CC(C)(C)OC1=O.
What is the InChIKey of 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate?
The InChIKey is QBPUSATZGKKPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO5S/c1-9(12-8-14(2,3)19-13(12)16)20-21(17,18)11-6-4-10(15)5-7-11/h4-7,9,12H,8H2,1-3H3.
What are the key properties of 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate?
1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate has a molecular weight of 332.81 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethyl-2-oxooxolan-3-yl)ethyl 4-chlorobenzenesulfonate is sourced from PubChem (CID 51351697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).