C11H19O7P2-3 — CID 51351721
[oxido-[(2E)-2,3,7-trimethylocta-2,6-dienoxy]phosphoryl] phosphate (PubChem CID 51351721) has the molecular formula C11H19O7P2-3 and a molecular weight of 325.21 g/mol. Its IUPAC name is [oxido-[(2E)-2,3,7-trimethylocta-2,6-dienoxy]phosphoryl] phosphate.
| Compound Name | [oxido-[(2E)-2,3,7-trimethylocta-2,6-dienoxy]phosphoryl] phosphate |
|---|---|
| PubChem CID | 51351721 |
| Molecular Formula | C11H19O7P2-3 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [oxido-[(2E)-2,3,7-trimethylocta-2,6-dienoxy]phosphoryl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C(\C)COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C11H22O7P2/c1-9(2)6-5-7-10(3)11(4)8-17-20(15,16)18-19(12,13)14/h6H,5,7-8H2,1-4H3,(H,15,16)(H2,12,13,14)/p-3/b11-10+ |
| InChIKey | PRUWPPRJQIGKNB-ZHACJKMWSA-K |
| XLogP | 1.40 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|