C17H15F5N4O2S — CID 51351840
(5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-[6-(trifluoromethyl)-3-pyridinyl]-6H-1,2,4-thiadiazin-3-amine (PubChem CID 51351840) has the molecular formula C17H15F5N4O2S and a molecular weight of 434.39 g/mol. Its IUPAC name is (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-[6-(trifluoromethyl)-3-pyridinyl]-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-[6-(trifluoromethyl)-3-pyridinyl]-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 51351840 |
| Molecular Formula | C17H15F5N4O2S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-[6-(trifluoromethyl)-3-pyridinyl]-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2ccc(F)cc2F)[C@@H](c2ccc(C(F)(F)F)nc2)S1(=O)=O |
| InChI | InChI=1S/C17H15F5N4O2S/c1-16(11-5-4-10(18)7-12(11)19)14(29(27,28)26(2)15(23)25-16)9-3-6-13(24-8-9)17(20,21)22/h3-8,14H,1-2H3,(H2,23,25)/t14-,16-/m1/s1 |
| InChIKey | JQVJROHRPSIFKE-GDBMZVCRSA-N |
| XLogP | 2.92 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |