C28H23N5O2S — CID 51352270
33-thia-4,12,14,25,27-pentazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione (PubChem CID 51352270) has the molecular formula C28H23N5O2S and a molecular weight of 493.59 g/mol. Its IUPAC name is 33-thia-4,12,14,25,27-pentazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione.
| Compound Name | 33-thia-4,12,14,25,27-pentazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione |
|---|---|
| PubChem CID | 51352270 |
| Molecular Formula | C28H23N5O2S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 33-thia-4,12,14,25,27-pentazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione |
| SMILES | O=C1NC(=O)C2=C1c1cn(c3ncccc13)CCCc1ccc(s1)CCCn1cc2c2cccnc21 |
| InChI | InChI=1S/C28H23N5O2S/c34-27-23-21-15-32(25-19(21)7-1-11-29-25)13-3-5-17-9-10-18(36-17)6-4-14-33-16-22(24(23)28(35)31-27)20-8-2-12-30-26(20)33/h1-2,7-12,15-16H,3-6,13-14H2,(H,31,34,35) |
| InChIKey | LOTNGDKDTCAIFT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|