C23H21F2N3O2S — CID 51352473
(5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-phenylphenyl)-6H-1,2,4-thiadiazin-3-amine (PubChem CID 51352473) has the molecular formula C23H21F2N3O2S and a molecular weight of 441.50 g/mol. Its IUPAC name is (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-phenylphenyl)-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-phenylphenyl)-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 51352473 |
| Molecular Formula | C23H21F2N3O2S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (5R,6R)-5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-phenylphenyl)-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2ccc(F)cc2F)[C@@H](c2ccc(-c3ccccc3)cc2)S1(=O)=O |
| InChI | InChI=1S/C23H21F2N3O2S/c1-23(19-13-12-18(24)14-20(19)25)21(31(29,30)28(2)22(26)27-23)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-14,21H,1-2H3,(H2,26,27)/t21-,23-/m1/s1 |
| InChIKey | IMBZAPVOEOGXGV-FYYLOGMGSA-N |
| XLogP | 4.18 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |