C20H11ClF2N2OS — CID 51352525
(E)-3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,5-difluorophenyl)prop-2-en-1-one (PubChem CID 51352525) has the molecular formula C20H11ClF2N2OS and a molecular weight of 400.84 g/mol. Its IUPAC name is (E)-3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,5-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,5-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51352525 |
| Molecular Formula | C20H11ClF2N2OS |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (E)-3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,5-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(-c2ccc(Cl)cc2)nc2sccn12)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H11ClF2N2OS/c21-14-3-1-12(2-4-14)19-17(25-7-8-27-20(25)24-19)5-6-18(26)13-9-15(22)11-16(23)10-13/h1-11H/b6-5+ |
| InChIKey | SKVRGAFOMHPIQY-AATRIKPKSA-N |
| XLogP | 5.89 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|