About N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide
N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 51352847) has the molecular formula C25H25N3O
and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide |
| PubChem CID | 51352847 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)cc1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3O/c29-24(25(14-15-25)19-4-2-1-3-5-19)26-20-10-12-21(13-11-20)28-23(18-8-9-18)16-22(27-28)17-6-7-17/h1-5,10-13,16-18H,6-9,14-15H2,(H,26,29) |
| InChIKey | BOXHKHYHOILBMO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide?
The IUPAC name of N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide (CID 51352847) is N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide.
What is the SMILES notation for N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide?
The canonical SMILES for N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide is O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)cc1)C1(c2ccccc2)CC1.
What is the InChIKey of N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide?
The InChIKey is BOXHKHYHOILBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O/c29-24(25(14-15-25)19-4-2-1-3-5-19)26-20-10-12-21(13-11-20)28-23(18-8-9-18)16-22(27-28)17-6-7-17/h1-5,10-13,16-18H,6-9,14-15H2,(H,26,29).
What are the key properties of N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide?
N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide has a molecular weight of 383.50 g/mol, XLogP of 5.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,5-dicyclopropylpyrazol-1-yl)phenyl]-1-phenylcyclopropane-1-carboxamide is sourced from PubChem (CID 51352847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).