C23H28 — CID 5135294
1-(4-pentylcyclohexen-1-yl)-4-phenylbenzene (PubChem CID 5135294) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-(4-pentylcyclohexen-1-yl)-4-phenylbenzene.
| Compound Name | 1-(4-pentylcyclohexen-1-yl)-4-phenylbenzene |
|---|---|
| PubChem CID | 5135294 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(4-pentylcyclohexen-1-yl)-4-phenylbenzene |
| SMILES | CCCCCC1CC=C(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H28/c1-2-3-5-8-19-11-13-21(14-12-19)23-17-15-22(16-18-23)20-9-6-4-7-10-20/h4,6-7,9-10,13,15-19H,2-3,5,8,11-12,14H2,1H3 |
| InChIKey | ONIUZKWYLVSNPD-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|