C24H27N2NaO6S2 — CID 51352950
sodium [2-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]-1,3-thiazol-4-yl]methanesulfonate (PubChem CID 51352950) has the molecular formula C24H27N2NaO6S2 and a molecular weight of 526.61 g/mol. Its IUPAC name is sodium [2-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]-1,3-thiazol-4-yl]methanesulfonate.
| Compound Name | sodium [2-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]-1,3-thiazol-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 51352950 |
| Molecular Formula | C24H27N2NaO6S2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | sodium [2-[[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]methyl]-1,3-thiazol-4-yl]methanesulfonate |
| SMILES | COc1cc(C(=O)N(CCCc2ccccc2)Cc2nc(CS(=O)(=O)[O-])cs2)cc(OC)c1C.[Na+] |
| InChI | InChI=1S/C24H28N2O6S2.Na/c1-17-21(31-2)12-19(13-22(17)32-3)24(27)26(11-7-10-18-8-5-4-6-9-18)14-23-25-20(15-33-23)16-34(28,29)30;/h4-6,8-9,12-13,15H,7,10-11,14,16H2,1-3H3,(H,28,29,30);/q;+1/p-1 |
| InChIKey | KBMNUDCZYAACHU-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|