About N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide
N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide (PubChem CID 51352974) has the molecular formula C21H18F2N4O
and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide |
| PubChem CID | 51352974 |
| Molecular Formula | C21H18F2N4O |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)nc1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H18F2N4O/c22-15-2-1-3-16(23)20(15)21(28)25-14-8-9-19(24-11-14)27-18(13-6-7-13)10-17(26-27)12-4-5-12/h1-3,8-13H,4-7H2,(H,25,28) |
| InChIKey | MIRYJPWBSQQCAQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide?
The IUPAC name of N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide (CID 51352974) is N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide is O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)nc1)c1c(F)cccc1F.
What is the InChIKey of N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide?
The InChIKey is MIRYJPWBSQQCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N4O/c22-15-2-1-3-16(23)20(15)21(28)25-14-8-9-19(24-11-14)27-18(13-6-7-13)10-17(26-27)12-4-5-12/h1-3,8-13H,4-7H2,(H,25,28).
What are the key properties of N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide?
N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide has a molecular weight of 380.40 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,5-dicyclopropylpyrazol-1-yl)-3-pyridinyl]-2,6-difluorobenzamide is sourced from PubChem (CID 51352974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).