C19H30N4O2S2 — CID 51353223
3-[[2-[(2S,6R)-2,6-di((113C)methyl)piperidin-1-yl]acetyl](15N)amino]-N-[2-(pyridin-2-yldisulfanyl)ethyl]propanamide (PubChem CID 51353223) has the molecular formula C19H30N4O2S2 and a molecular weight of 415.57 g/mol. Its IUPAC name is 3-[[2-[(2S,6R)-2,6-di((113C)methyl)piperidin-1-yl]acetyl](15N)amino]-N-[2-(pyridin-2-yldisulfanyl)ethyl]propanamide.
| Compound Name | 3-[[2-[(2S,6R)-2,6-di((113C)methyl)piperidin-1-yl]acetyl](15N)amino]-N-[2-(pyridin-2-yldisulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 51353223 |
| Molecular Formula | C19H30N4O2S2 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3-[[2-[(2S,6R)-2,6-di((113C)methyl)piperidin-1-yl]acetyl](15N)amino]-N-[2-(pyridin-2-yldisulfanyl)ethyl]propanamide |
| SMILES | [13CH3][C@@H]1CCC[C@H]([13CH3])N1[13CH2][13C](=O)[15NH]CCC(=O)NCCSSc1ccccn1 |
| InChI | InChI=1S/C19H30N4O2S2/c1-15-6-5-7-16(2)23(15)14-18(25)20-11-9-17(24)21-12-13-26-27-19-8-3-4-10-22-19/h3-4,8,10,15-16H,5-7,9,11-14H2,1-2H3,(H,20,25)(H,21,24)/t15-,16+/i1+1,2+1,14+1,18+1,20+1 |
| InChIKey | WUGRGOAXGKISAI-XAJCYOLASA-N |
| XLogP | 2.71 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|