About 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide
1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide (PubChem CID 5135335) has the molecular formula C13H14Cl2N2O2
and a molecular weight of 301.17 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide |
| PubChem CID | 5135335 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide |
| SMILES | [O-][N+](=Cc1ccc(Cl)cc1Cl)C1CCCCC1=NO |
| InChI | InChI=1S/C13H14Cl2N2O2/c14-10-6-5-9(11(15)7-10)8-17(19)13-4-2-1-3-12(13)16-18/h5-8,13,18H,1-4H2 |
| InChIKey | MODWJFHNSUOPKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide?
The IUPAC name of 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide (CID 5135335) is 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide?
The canonical SMILES for 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide is [O-][N+](=Cc1ccc(Cl)cc1Cl)C1CCCCC1=NO.
What is the InChIKey of 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide?
The InChIKey is MODWJFHNSUOPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O2/c14-10-6-5-9(11(15)7-10)8-17(19)13-4-2-1-3-12(13)16-18/h5-8,13,18H,1-4H2.
What are the key properties of 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide?
1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide has a molecular weight of 301.17 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-N-(2-hydroxyiminocyclohexyl)methanimine oxide is sourced from PubChem (CID 5135335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).