C21H14F2N2O2S — CID 51353477
(E)-1-(3,5-difluorophenyl)-3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-en-1-one (PubChem CID 51353477) has the molecular formula C21H14F2N2O2S and a molecular weight of 396.42 g/mol. Its IUPAC name is (E)-1-(3,5-difluorophenyl)-3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,5-difluorophenyl)-3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 51353477 |
| Molecular Formula | C21H14F2N2O2S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (E)-1-(3,5-difluorophenyl)-3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-en-1-one |
| SMILES | COc1ccc(-c2nc3sccn3c2/C=C/C(=O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C21H14F2N2O2S/c1-27-17-4-2-13(3-5-17)20-18(25-8-9-28-21(25)24-20)6-7-19(26)14-10-15(22)12-16(23)11-14/h2-12H,1H3/b7-6+ |
| InChIKey | XQAHSDNITBLLGE-VOTSOKGWSA-N |
| XLogP | 5.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|