C17H28O3 — CID 51353965
ethyl (3aS,4R,6aS)-4-hydroxy-5,5,6a-trimethyl-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate (PubChem CID 51353965) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl (3aS,4R,6aS)-4-hydroxy-5,5,6a-trimethyl-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate.
| Compound Name | ethyl (3aS,4R,6aS)-4-hydroxy-5,5,6a-trimethyl-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 51353965 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl (3aS,4R,6aS)-4-hydroxy-5,5,6a-trimethyl-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=C(C)C)CC[C@@]1(C)CC(C)(C)[C@H]2O |
| InChI | InChI=1S/C17H28O3/c1-7-20-14(19)17-12(11(2)3)8-9-16(17,6)10-15(4,5)13(17)18/h13,18H,7-10H2,1-6H3/t13-,16+,17-/m1/s1 |
| InChIKey | NENIDILDZVTIOL-XOKHGSTOSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|