C18H20N2O4S — CID 51353973
N-cyclohexyl-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 51353973) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-cyclohexyl-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 51353973 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-cyclohexyl-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=O)NC2=O)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H20N2O4S/c21-16(19-13-4-2-1-3-5-13)11-24-14-8-6-12(7-9-14)10-15-17(22)20-18(23)25-15/h6-10,13H,1-5,11H2,(H,19,21)(H,20,22,23)/b15-10- |
| InChIKey | SXJNPXFBRFFSJI-GDNBJRDFSA-N |
| XLogP | 2.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|