C27H30ClNO — CID 51353977
1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]hexan-1-one (PubChem CID 51353977) has the molecular formula C27H30ClNO and a molecular weight of 420.00 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]hexan-1-one.
| Compound Name | 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 51353977 |
| Molecular Formula | C27H30ClNO |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]hexan-1-one |
| SMILES | CCCCCC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CC(C)(C)C2 |
| InChI | InChI=1S/C27H30ClNO/c1-4-5-7-12-23(30)26-25(20-13-15-21(28)16-14-20)24(19-10-8-6-9-11-19)22-17-27(2,3)18-29(22)26/h6,8-11,13-16H,4-5,7,12,17-18H2,1-3H3 |
| InChIKey | MFRJJTWILUBONP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|