About 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone
2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone (PubChem CID 51353978) has the molecular formula C23H21Cl2NO
and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone |
| PubChem CID | 51353978 |
| Molecular Formula | C23H21Cl2NO |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone |
| SMILES | CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Cl)cc3)c(C(=O)CCl)n2C1 |
| InChI | InChI=1S/C23H21Cl2NO/c1-23(2)12-18-20(15-6-4-3-5-7-15)21(16-8-10-17(25)11-9-16)22(19(27)13-24)26(18)14-23/h3-11H,12-14H2,1-2H3 |
| InChIKey | VTCFHPGALJKULJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The IUPAC name of 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone (CID 51353978) is 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone.
What is the SMILES notation for 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The canonical SMILES for 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone is CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Cl)cc3)c(C(=O)CCl)n2C1.
What is the InChIKey of 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
The InChIKey is VTCFHPGALJKULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21Cl2NO/c1-23(2)12-18-20(15-6-4-3-5-7-15)21(16-8-10-17(25)11-9-16)22(19(27)13-24)26(18)14-23/h3-11H,12-14H2,1-2H3.
What are the key properties of 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone?
2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone has a molecular weight of 398.33 g/mol, XLogP of 6.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]ethanone is sourced from PubChem (CID 51353978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).