C24H34O3 — CID 51354259
ethyl (3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate (PubChem CID 51354259) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl (3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate.
| Compound Name | ethyl (3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 51354259 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl (3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-propan-2-ylidene-1,2,4,6-tetrahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=C(C)C)CC[C@@]1(C)CC(C)(C)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C24H34O3/c1-7-26-21(25)24-19(17(2)3)13-14-23(24,6)16-22(4,5)20(24)27-15-18-11-9-8-10-12-18/h8-12,20H,7,13-16H2,1-6H3/t20-,23+,24-/m1/s1 |
| InChIKey | QSMKTXVWSKDFEF-FGCOXFRFSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|