C24H32O3 — CID 51354261
ethyl (3R,3aS,6aS)-2,2,6a-trimethyl-3-phenylmethoxy-4-prop-1-en-2-yl-3,6-dihydro-1H-pentalene-3a-carboxylate (PubChem CID 51354261) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl (3R,3aS,6aS)-2,2,6a-trimethyl-3-phenylmethoxy-4-prop-1-en-2-yl-3,6-dihydro-1H-pentalene-3a-carboxylate.
| Compound Name | ethyl (3R,3aS,6aS)-2,2,6a-trimethyl-3-phenylmethoxy-4-prop-1-en-2-yl-3,6-dihydro-1H-pentalene-3a-carboxylate |
|---|---|
| PubChem CID | 51354261 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethyl (3R,3aS,6aS)-2,2,6a-trimethyl-3-phenylmethoxy-4-prop-1-en-2-yl-3,6-dihydro-1H-pentalene-3a-carboxylate |
| SMILES | C=C(C)C1=CC[C@@]2(C)CC(C)(C)[C@@H](OCc3ccccc3)[C@@]12C(=O)OCC |
| InChI | InChI=1S/C24H32O3/c1-7-26-21(25)24-19(17(2)3)13-14-23(24,6)16-22(4,5)20(24)27-15-18-11-9-8-10-12-18/h8-13,20H,2,7,14-16H2,1,3-6H3/t20-,23+,24-/m1/s1 |
| InChIKey | NQEOAISLOQXICH-FGCOXFRFSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |