C26H32N6O5S — CID 51354462
ethyl 2-[[C-[5-(4-cyanophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate (PubChem CID 51354462) has the molecular formula C26H32N6O5S and a molecular weight of 540.65 g/mol. Its IUPAC name is ethyl 2-[[C-[5-(4-cyanophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 2-[[C-[5-(4-cyanophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 51354462 |
| Molecular Formula | C26H32N6O5S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | ethyl 2-[[C-[5-(4-cyanophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl-ethylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(C(C)O)N(CC)S(=O)(=O)N/C(=N/C)N1CC(c2ccccc2)C(c2ccc(C#N)cc2)=N1 |
| InChI | InChI=1S/C26H32N6O5S/c1-5-32(24(18(3)33)25(34)37-6-2)38(35,36)30-26(28-4)31-17-22(20-10-8-7-9-11-20)23(29-31)21-14-12-19(16-27)13-15-21/h7-15,18,22,24,33H,5-6,17H2,1-4H3,(H,28,30) |
| InChIKey | PMXAMYGSVUSWOU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|