C28H32O4S — CID 51354547
(1R,5R,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undec-3-en-2-one (PubChem CID 51354547) has the molecular formula C28H32O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is (1R,5R,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undec-3-en-2-one.
| Compound Name | (1R,5R,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undec-3-en-2-one |
|---|---|
| PubChem CID | 51354547 |
| Molecular Formula | C28H32O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (1R,5R,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undec-3-en-2-one |
| SMILES | CC1=C(S(=O)(=O)c2ccccc2)C(=O)[C@@]23[C@H](OCc4ccccc4)C(C)(C)C[C@]2(C)CC[C@@H]13 |
| InChI | InChI=1S/C28H32O4S/c1-19-22-15-16-27(4)18-26(2,3)25(32-17-20-11-7-5-8-12-20)28(22,27)24(29)23(19)33(30,31)21-13-9-6-10-14-21/h5-14,22,25H,15-18H2,1-4H3/t22-,25+,27-,28-/m0/s1 |
| InChIKey | BUSUMGOKHQNWBG-MZRLSVQCSA-N |
| XLogP | 5.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |