C28H34O4S — CID 51354549
(1R,3R,4S,5S,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 51354549) has the molecular formula C28H34O4S and a molecular weight of 466.64 g/mol. Its IUPAC name is (1R,3R,4S,5S,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1R,3R,4S,5S,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 51354549 |
| Molecular Formula | C28H34O4S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (1R,3R,4S,5S,8S,11R)-3-(benzenesulfonyl)-4,8,10,10-tetramethyl-11-phenylmethoxytricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | C[C@H]1[C@@H]2CC[C@@]3(C)CC(C)(C)[C@@H](OCc4ccccc4)[C@@]23C(=O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H34O4S/c1-19-22-15-16-27(4)18-26(2,3)25(32-17-20-11-7-5-8-12-20)28(22,27)24(29)23(19)33(30,31)21-13-9-6-10-14-21/h5-14,19,22-23,25H,15-18H2,1-4H3/t19-,22-,23+,25+,27-,28-/m0/s1 |
| InChIKey | LSQYCBIHMJCWEH-SVYLHKONSA-N |
| XLogP | 5.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |