C16H28O2Si — CID 51354688
1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylocta-3,4,7-trien-2-one (PubChem CID 51354688) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylocta-3,4,7-trien-2-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylocta-3,4,7-trien-2-one |
|---|---|
| PubChem CID | 51354688 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylocta-3,4,7-trien-2-one |
| SMILES | C=CCC(C)=C=C(C)C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-9-10-13(2)11-14(3)15(17)12-18-19(7,8)16(4,5)6/h9H,1,10,12H2,2-8H3 |
| InChIKey | IKRRFTPUPZDJCO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|