C21H27N3O4 — CID 5135490
N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 5135490) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5135490 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)Cc2ccc(OC)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-5-24(6-2)17-9-8-16(18(25)13-17)14-22-23-21(26)12-15-7-10-19(27-3)20(11-15)28-4/h7-11,13-14,25H,5-6,12H2,1-4H3,(H,23,26) |
| InChIKey | WLVLSSHDSLNRBM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|