About silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride
silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride (PubChem CID 51355055) has the molecular formula C5H8AgCl3N2
and a molecular weight of 310.36 g/mol. Its IUPAC name is silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride.
Molecular Properties
| Compound Name | silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride |
| PubChem CID | 51355055 |
| Molecular Formula | C5H8AgCl3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride |
| SMILES | CN1[CH-]N(C)C(Cl)=C1Cl.Cl.[Ag+] |
| InChI | InChI=1S/C5H7Cl2N2.Ag.ClH/c1-8-3-9(2)5(7)4(8)6;;/h3H,1-2H3;;1H/q-1;+1; |
| InChIKey | HEPHLDDODHQVIY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride?
The IUPAC name of silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride (CID 51355055) is silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride.
What is the SMILES notation for silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride?
The canonical SMILES for silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride is CN1[CH-]N(C)C(Cl)=C1Cl.Cl.[Ag+].
What is the InChIKey of silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride?
The InChIKey is HEPHLDDODHQVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Cl2N2.Ag.ClH/c1-8-3-9(2)5(7)4(8)6;;/h3H,1-2H3;;1H/q-1;+1;.
What are the key properties of silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride?
silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride has a molecular weight of 310.36 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver;4,5-dichloro-1,3-dimethyl-2H-imidazol-2-ide;hydrochloride is sourced from PubChem (CID 51355055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).