C21H28F3NO5 — CID 51355076
cyclohexyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 51355076) has the molecular formula C21H28F3NO5 and a molecular weight of 431.45 g/mol. Its IUPAC name is cyclohexyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | cyclohexyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 51355076 |
| Molecular Formula | C21H28F3NO5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | cyclohexyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H28F3NO5/c1-21(2,3)30-20(28)25-17(11-18(26)29-12-7-5-4-6-8-12)19(27)13-9-15(23)16(24)10-14(13)22/h9-10,12,17,19,27H,4-8,11H2,1-3H3,(H,25,28)/t17-,19?/m0/s1 |
| InChIKey | DXQSZBOUCDFACL-KKFHFHRHSA-N |
| XLogP | 4.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|