About (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran
(2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran (PubChem CID 51355110) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran |
| PubChem CID | 51355110 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCCCCC[C@@H]1CC(OCC)=C[C@H](C)O1 |
| InChI | InChI=1S/C18H34O2/c1-4-6-7-8-9-10-11-12-13-17-15-18(19-5-2)14-16(3)20-17/h14,16-17H,4-13,15H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | FUDCXEZZGFNWKJ-DLBZAZTESA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran?
The IUPAC name of (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran (CID 51355110) is (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran is CCCCCCCCCC[C@@H]1CC(OCC)=C[C@H](C)O1.
What is the InChIKey of (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran?
The InChIKey is FUDCXEZZGFNWKJ-DLBZAZTESA-N. The full InChI is InChI=1S/C18H34O2/c1-4-6-7-8-9-10-11-12-13-17-15-18(19-5-2)14-16(3)20-17/h14,16-17H,4-13,15H2,1-3H3/t16-,17+/m0/s1.
What are the key properties of (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran?
(2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran has a molecular weight of 282.47 g/mol, XLogP of 5.61, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2-decyl-4-ethoxy-6-methyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 51355110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).