C10H19NO3 — CID 51355111
(3S,5S)-3,5-dihydroxy-N,4,4-trimethylhept-6-enamide (PubChem CID 51355111) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (3S,5S)-3,5-dihydroxy-N,4,4-trimethylhept-6-enamide.
| Compound Name | (3S,5S)-3,5-dihydroxy-N,4,4-trimethylhept-6-enamide |
|---|---|
| PubChem CID | 51355111 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (3S,5S)-3,5-dihydroxy-N,4,4-trimethylhept-6-enamide |
| SMILES | C=C[C@H](O)C(C)(C)[C@@H](O)CC(=O)NC |
| InChI | InChI=1S/C10H19NO3/c1-5-7(12)10(2,3)8(13)6-9(14)11-4/h5,7-8,12-13H,1,6H2,2-4H3,(H,11,14)/t7-,8-/m0/s1 |
| InChIKey | VEYGKDKBKWOYOF-YUMQZZPRSA-N |
| XLogP | 0.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|