C12H16N4O3 — CID 51355131
7-methoxy-1-oxido-N-(propoxymethyl)-1,2,4-benzotriazin-1-ium-3-amine (PubChem CID 51355131) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 7-methoxy-1-oxido-N-(propoxymethyl)-1,2,4-benzotriazin-1-ium-3-amine.
| Compound Name | 7-methoxy-1-oxido-N-(propoxymethyl)-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| PubChem CID | 51355131 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 7-methoxy-1-oxido-N-(propoxymethyl)-1,2,4-benzotriazin-1-ium-3-amine |
| SMILES | CCCOCNc1nc2ccc(OC)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C12H16N4O3/c1-3-6-19-8-13-12-14-10-5-4-9(18-2)7-11(10)16(17)15-12/h4-5,7H,3,6,8H2,1-2H3,(H,13,14,15) |
| InChIKey | NTIDZFGKHHKFMT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|