C24H23ClN4O3S2 — CID 51355171
N-[6-[5-[(3-tert-butylphenyl)sulfonylamino]-6-chloro-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 51355171) has the molecular formula C24H23ClN4O3S2 and a molecular weight of 515.06 g/mol. Its IUPAC name is N-[6-[5-[(3-tert-butylphenyl)sulfonylamino]-6-chloro-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[5-[(3-tert-butylphenyl)sulfonylamino]-6-chloro-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51355171 |
| Molecular Formula | C24H23ClN4O3S2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[6-[5-[(3-tert-butylphenyl)sulfonylamino]-6-chloro-3-pyridinyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(-c3cnc(Cl)c(NS(=O)(=O)c4cccc(C(C)(C)C)c4)c3)cc2s1 |
| InChI | InChI=1S/C24H23ClN4O3S2/c1-14(30)27-23-28-19-9-8-15(11-21(19)33-23)16-10-20(22(25)26-13-16)29-34(31,32)18-7-5-6-17(12-18)24(2,3)4/h5-13,29H,1-4H3,(H,27,28,30) |
| InChIKey | RGEBDUAFRMIURN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|